About 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine
8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine (PubChem CID 143686064) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine.
Analyze 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine?
The IUPAC name of 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine (CID 143686064) is 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine.
What is the SMILES notation for 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine?
The canonical SMILES for 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine is CC1(C)C=CC=C2CNCOC2=C1.
What is the InChIKey of 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine?
The InChIKey is HAQPZCRPFPPVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-11(2)5-3-4-9-7-12-8-13-10(9)6-11/h3-6,12H,7-8H2,1-2H3.
What are the key properties of 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine?
8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine has a molecular weight of 177.25 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-3,4-dihydro-2H-cyclohepta[e][1,3]oxazine is sourced from PubChem (CID 143686064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).