About 1-butyl-2-ethylcyclopropane;1-methoxypropane
1-butyl-2-ethylcyclopropane;1-methoxypropane (PubChem CID 143686093) has the molecular formula C13H28O
and a molecular weight of 200.37 g/mol. Its IUPAC name is 1-butyl-2-ethylcyclopropane;1-methoxypropane.
Molecular Properties
| Compound Name | 1-butyl-2-ethylcyclopropane;1-methoxypropane |
| PubChem CID | 143686093 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | 1-butyl-2-ethylcyclopropane;1-methoxypropane |
| SMILES | CCCCC1CC1CC.CCCOC |
| InChI | InChI=1S/C9H18.C4H10O/c1-3-5-6-9-7-8(9)4-2;1-3-4-5-2/h8-9H,3-7H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | YILQKIOKLOKNDJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-2-ethylcyclopropane;1-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-ethylcyclopropane;1-methoxypropane?
The IUPAC name of 1-butyl-2-ethylcyclopropane;1-methoxypropane (CID 143686093) is 1-butyl-2-ethylcyclopropane;1-methoxypropane.
What is the SMILES notation for 1-butyl-2-ethylcyclopropane;1-methoxypropane?
The canonical SMILES for 1-butyl-2-ethylcyclopropane;1-methoxypropane is CCCCC1CC1CC.CCCOC.
What is the InChIKey of 1-butyl-2-ethylcyclopropane;1-methoxypropane?
The InChIKey is YILQKIOKLOKNDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C4H10O/c1-3-5-6-9-7-8(9)4-2;1-3-4-5-2/h8-9H,3-7H2,1-2H3;3-4H2,1-2H3.
What are the key properties of 1-butyl-2-ethylcyclopropane;1-methoxypropane?
1-butyl-2-ethylcyclopropane;1-methoxypropane has a molecular weight of 200.37 g/mol, XLogP of 4.27, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-ethylcyclopropane;1-methoxypropane is sourced from PubChem (CID 143686093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).