C41H46F3N2OP — CID 143686410
benzene;[2-[2-[cyclohexyl(hexyl)phosphanyl]phenyl]-4-phenyl-4,5-dihydroimidazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 143686410) has the molecular formula C41H46F3N2OP and a molecular weight of 670.80 g/mol. Its IUPAC name is benzene;[2-[2-[cyclohexyl(hexyl)phosphanyl]phenyl]-4-phenyl-4,5-dihydroimidazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | benzene;[2-[2-[cyclohexyl(hexyl)phosphanyl]phenyl]-4-phenyl-4,5-dihydroimidazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 143686410 |
| Molecular Formula | C41H46F3N2OP |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | benzene;[2-[2-[cyclohexyl(hexyl)phosphanyl]phenyl]-4-phenyl-4,5-dihydroimidazol-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | CCCCCCP(c1ccccc1C1=NC(c2ccccc2)CN1C(=O)c1ccc(C(F)(F)F)cc1)C1CCCCC1.c1ccccc1 |
| InChI | InChI=1S/C35H40F3N2OP.C6H6/c1-2-3-4-13-24-42(29-16-9-6-10-17-29)32-19-12-11-18-30(32)33-39-31(26-14-7-5-8-15-26)25-40(33)34(41)27-20-22-28(23-21-27)35(36,37)38;1-2-4-6-5-3-1/h5,7-8,11-12,14-15,18-23,29,31H,2-4,6,9-10,13,16-17,24-25H2,1H3;1-6H |
| InChIKey | SBDLHTKZAJGRMW-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|