About (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen
(2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen (PubChem CID 143686425) has the molecular formula C22H20F3N3O
and a molecular weight of 399.42 g/mol. Its IUPAC name is (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen.
Molecular Properties
| Compound Name | (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen |
| PubChem CID | 143686425 |
| Molecular Formula | C22H20F3N3O |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen |
| SMILES | Cc1ccc2c(=O)[nH]c(-c3ccccc3F)nc2c1.NCc1ccc(F)cc1F.[H][H] |
| InChI | InChI=1S/C15H11FN2O.C7H7F2N.H2/c1-9-6-7-11-13(8-9)17-14(18-15(11)19)10-4-2-3-5-12(10)16;8-6-2-1-5(4-10)7(9)3-6;/h2-8H,1H3,(H,17,18,19);1-3H,4,10H2;1H |
| InChIKey | UEGWHWWNPWEEES-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen?
The IUPAC name of (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen (CID 143686425) is (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen.
What is the SMILES notation for (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen?
The canonical SMILES for (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen is Cc1ccc2c(=O)[nH]c(-c3ccccc3F)nc2c1.NCc1ccc(F)cc1F.[H][H].
What is the InChIKey of (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen?
The InChIKey is UEGWHWWNPWEEES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN2O.C7H7F2N.H2/c1-9-6-7-11-13(8-9)17-14(18-15(11)19)10-4-2-3-5-12(10)16;8-6-2-1-5(4-10)7(9)3-6;/h2-8H,1H3,(H,17,18,19);1-3H,4,10H2;1H.
What are the key properties of (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen?
(2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen has a molecular weight of 399.42 g/mol, XLogP of 4.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenyl)methanamine;2-(2-fluorophenyl)-7-methyl-3H-quinazolin-4-one;molecular hydrogen is sourced from PubChem (CID 143686425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).