C27H49N — CID 143687353
10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-amine (PubChem CID 143687353) has the molecular formula C27H49N and a molecular weight of 387.70 g/mol. Its IUPAC name is 10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-amine.
| Compound Name | 10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-amine |
|---|---|
| PubChem CID | 143687353 |
| Molecular Formula | C27H49N |
| Molecular Weight | 387.70 g/mol |
| Exact Mass | 387.39 |
| IUPAC Name | 10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-amine |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3CCC4CCC(N)CC4(C)C3CCC21C |
| InChI | InChI=1S/C27H49N/c1-18(2)7-6-8-19(3)23-13-14-24-22-12-10-20-9-11-21(28)17-27(20,5)25(22)15-16-26(23,24)4/h18-25H,6-17,28H2,1-5H3/t19-,20?,21?,22?,23?,24?,25?,26?,27?/m1/s1 |
| InChIKey | RAAXDEUKABNQEU-YRZBJZLASA-N |
| XLogP | 7.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.70 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |