C17H17FN4O — CID 143687453
N-cyclohexyl-4-(5-fluoro-1,2-benzoxazol-3-yl)pyrimidin-2-amine (PubChem CID 143687453) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is N-cyclohexyl-4-(5-fluoro-1,2-benzoxazol-3-yl)pyrimidin-2-amine.
| Compound Name | N-cyclohexyl-4-(5-fluoro-1,2-benzoxazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143687453 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-cyclohexyl-4-(5-fluoro-1,2-benzoxazol-3-yl)pyrimidin-2-amine |
| SMILES | Fc1ccc2onc(-c3ccnc(NC4CCCCC4)n3)c2c1 |
| InChI | InChI=1S/C17H17FN4O/c18-11-6-7-15-13(10-11)16(22-23-15)14-8-9-19-17(21-14)20-12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H,19,20,21) |
| InChIKey | QGHZVPKVIQIEQB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |