About anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate
anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 143687824) has the molecular formula C23H23NO4
and a molecular weight of 377.44 g/mol. Its IUPAC name is anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate |
| PubChem CID | 143687824 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(N)C(=O)OCc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C18H15NO2.C5H8O2/c1-12(19)18(20)21-11-17-15-8-4-2-6-13(15)10-14-7-3-5-9-16(14)17;1-4(2)5(6)7-3/h2-10H,1,11,19H2;1H2,2-3H3 |
| InChIKey | DNOGYFNAMILLKU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate?
The IUPAC name of anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate (CID 143687824) is anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate.
What is the SMILES notation for anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate?
The canonical SMILES for anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.C=C(N)C(=O)OCc1c2ccccc2cc2ccccc12.
What is the InChIKey of anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate?
The InChIKey is DNOGYFNAMILLKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO2.C5H8O2/c1-12(19)18(20)21-11-17-15-8-4-2-6-13(15)10-14-7-3-5-9-16(14)17;1-4(2)5(6)7-3/h2-10H,1,11,19H2;1H2,2-3H3.
What are the key properties of anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate?
anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate has a molecular weight of 377.44 g/mol, XLogP of 4.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-ylmethyl 2-aminoprop-2-enoate;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 143687824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).