C17H22FN3O2 — CID 143687911
ethanol;1-ethyl-3-[(2-fluoroethylamino)methyl]-2-oxoquinoline-7-carbonitrile (PubChem CID 143687911) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is ethanol;1-ethyl-3-[(2-fluoroethylamino)methyl]-2-oxoquinoline-7-carbonitrile.
| Compound Name | ethanol;1-ethyl-3-[(2-fluoroethylamino)methyl]-2-oxoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 143687911 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | ethanol;1-ethyl-3-[(2-fluoroethylamino)methyl]-2-oxoquinoline-7-carbonitrile |
| SMILES | CCO.CCn1c(=O)c(CNCCF)cc2ccc(C#N)cc21 |
| InChI | InChI=1S/C15H16FN3O.C2H6O/c1-2-19-14-7-11(9-17)3-4-12(14)8-13(15(19)20)10-18-6-5-16;1-2-3/h3-4,7-8,18H,2,5-6,10H2,1H3;3H,2H2,1H3 |
| InChIKey | SWHSYJUDQOGKPT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|