C26H25F3N2O4 — CID 143687918
1-(2-ethoxyethyl)-3-[(furan-2-ylmethylamino)methyl]-7-[4-(trifluoromethoxy)phenyl]quinolin-2-one (PubChem CID 143687918) has the molecular formula C26H25F3N2O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-[(furan-2-ylmethylamino)methyl]-7-[4-(trifluoromethoxy)phenyl]quinolin-2-one.
| Compound Name | 1-(2-ethoxyethyl)-3-[(furan-2-ylmethylamino)methyl]-7-[4-(trifluoromethoxy)phenyl]quinolin-2-one |
|---|---|
| PubChem CID | 143687918 |
| Molecular Formula | C26H25F3N2O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-[(furan-2-ylmethylamino)methyl]-7-[4-(trifluoromethoxy)phenyl]quinolin-2-one |
| SMILES | CCOCCn1c(=O)c(CNCc2ccco2)cc2ccc(-c3ccc(OC(F)(F)F)cc3)cc21 |
| InChI | InChI=1S/C26H25F3N2O4/c1-2-33-13-11-31-24-15-19(18-7-9-22(10-8-18)35-26(27,28)29)5-6-20(24)14-21(25(31)32)16-30-17-23-4-3-12-34-23/h3-10,12,14-15,30H,2,11,13,16-17H2,1H3 |
| InChIKey | ZAAFROQIVIOUGR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|