C28H30N2O6 — CID 143688154
ethyl 5-[[[1-(2-ethoxyethyl)-2-oxo-7-phenoxyquinolin-3-yl]methylamino]methyl]furan-2-carboxylate (PubChem CID 143688154) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is ethyl 5-[[[1-(2-ethoxyethyl)-2-oxo-7-phenoxyquinolin-3-yl]methylamino]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[[1-(2-ethoxyethyl)-2-oxo-7-phenoxyquinolin-3-yl]methylamino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 143688154 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | ethyl 5-[[[1-(2-ethoxyethyl)-2-oxo-7-phenoxyquinolin-3-yl]methylamino]methyl]furan-2-carboxylate |
| SMILES | CCOCCn1c(=O)c(CNCc2ccc(C(=O)OCC)o2)cc2ccc(Oc3ccccc3)cc21 |
| InChI | InChI=1S/C28H30N2O6/c1-3-33-15-14-30-25-17-23(35-22-8-6-5-7-9-22)11-10-20(25)16-21(27(30)31)18-29-19-24-12-13-26(36-24)28(32)34-4-2/h5-13,16-17,29H,3-4,14-15,18-19H2,1-2H3 |
| InChIKey | QHTMIURGUPFSPC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|