C16H16 — CID 143688466
5-ethenyl-6-methylidene-2-(3-methylphenyl)cyclohexa-1,3-diene (PubChem CID 143688466) has the molecular formula C16H16 and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-ethenyl-6-methylidene-2-(3-methylphenyl)cyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-6-methylidene-2-(3-methylphenyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143688466 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5-ethenyl-6-methylidene-2-(3-methylphenyl)cyclohexa-1,3-diene |
| SMILES | C=CC1C=CC(c2cccc(C)c2)=CC1=C |
| InChI | InChI=1S/C16H16/c1-4-14-8-9-16(11-13(14)3)15-7-5-6-12(2)10-15/h4-11,14H,1,3H2,2H3 |
| InChIKey | XUOGDCVEKXDDJF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|