C17H23NO — CID 143689032
(1S,9R,10S,13S)-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-10-ol (PubChem CID 143689032) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (1S,9R,10S,13S)-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-10-ol.
| Compound Name | (1S,9R,10S,13S)-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-10-ol |
|---|---|
| PubChem CID | 143689032 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (1S,9R,10S,13S)-13-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-10-ol |
| SMILES | C[C@H]1CC[C@@]2(O)[C@H]3Cc4ccccc4[C@@]2(CCN3)C1 |
| InChI | InChI=1S/C17H23NO/c1-12-6-7-17(19)15-10-13-4-2-3-5-14(13)16(17,11-12)8-9-18-15/h2-5,12,15,18-19H,6-11H2,1H3/t12-,15+,16+,17+/m0/s1 |
| InChIKey | STTDWVSVJDSKTC-WBQNTZJQSA-N |
| XLogP | 2.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |