C26H23F4N3O2 — CID 143689424
(2R)-1-[3-[2,2,2-trifluoro-1-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-1-hydroxyethyl]indol-1-yl]propan-2-ol (PubChem CID 143689424) has the molecular formula C26H23F4N3O2 and a molecular weight of 485.48 g/mol. Its IUPAC name is (2R)-1-[3-[2,2,2-trifluoro-1-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-1-hydroxyethyl]indol-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[3-[2,2,2-trifluoro-1-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-1-hydroxyethyl]indol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 143689424 |
| Molecular Formula | C26H23F4N3O2 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (2R)-1-[3-[2,2,2-trifluoro-1-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-1-hydroxyethyl]indol-1-yl]propan-2-ol |
| SMILES | [H]/N=C/c1cc(C(O)(c2cn(C[C@@H](C)O)c3ccccc23)C(F)(F)F)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H23F4N3O2/c1-16(34)14-33-15-22(21-4-2-3-5-24(21)33)25(35,26(28,29)30)18-6-11-23(17(12-18)13-31)32-20-9-7-19(27)8-10-20/h2-13,15-16,31-32,34-35H,14H2,1H3/b31-13+/t16-,25?/m1/s1 |
| InChIKey | PYQXZYBZIKIZRB-FBXRHVJISA-N |
| XLogP | 5.70 |
| TPSA | 81.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|