C22H16F4N4O — CID 143689485
2,2,2-trifluoro-1-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-1-(2H-indazol-3-yl)ethanol (PubChem CID 143689485) has the molecular formula C22H16F4N4O and a molecular weight of 428.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-1-(2H-indazol-3-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-1-(2H-indazol-3-yl)ethanol |
|---|---|
| PubChem CID | 143689485 |
| Molecular Formula | C22H16F4N4O |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(4-fluoroanilino)-3-methanimidoylphenyl]-1-(2H-indazol-3-yl)ethanol |
| SMILES | [H]/N=C/c1cc(C(O)(c2[nH]nc3ccccc23)C(F)(F)F)ccc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H16F4N4O/c23-15-6-8-16(9-7-15)28-18-10-5-14(11-13(18)12-27)21(31,22(24,25)26)20-17-3-1-2-4-19(17)29-30-20/h1-12,27-28,31H,(H,29,30)/b27-12+ |
| InChIKey | YTKSKVBSZCOJLJ-KKMKTNMSSA-N |
| XLogP | 5.24 |
| TPSA | 84.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|