C33H35NO5 — CID 143690361
2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl 2,7,7-trimethyl-5-oxo-4-(3-phenoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 143690361) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl 2,7,7-trimethyl-5-oxo-4-(3-phenoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl 2,7,7-trimethyl-5-oxo-4-(3-phenoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 143690361 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl 2,7,7-trimethyl-5-oxo-4-(3-phenoxyphenyl)-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | C=C/C=C(\C=C)OCCOC(=O)C1=C(C)NC2=C(C(=O)CC(C)(C)C2)C1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C33H35NO5/c1-6-12-24(7-2)37-17-18-38-32(36)29-22(3)34-27-20-33(4,5)21-28(35)31(27)30(29)23-13-11-16-26(19-23)39-25-14-9-8-10-15-25/h6-16,19,30,34H,1-2,17-18,20-21H2,3-5H3/b24-12+ |
| InChIKey | YVJKNCUXFQHFNP-WYMPLXKRSA-N |
| XLogP | 6.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|