C15H24F2N2O3 — CID 143690453
acetamide;3-(difluoromethoxy)-N-[(2E,4Z,6Z)-2-methylocta-2,4,6-trienyl]propanamide (PubChem CID 143690453) has the molecular formula C15H24F2N2O3 and a molecular weight of 318.36 g/mol. Its IUPAC name is acetamide;3-(difluoromethoxy)-N-[(2E,4Z,6Z)-2-methylocta-2,4,6-trienyl]propanamide.
| Compound Name | acetamide;3-(difluoromethoxy)-N-[(2E,4Z,6Z)-2-methylocta-2,4,6-trienyl]propanamide |
|---|---|
| PubChem CID | 143690453 |
| Molecular Formula | C15H24F2N2O3 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | acetamide;3-(difluoromethoxy)-N-[(2E,4Z,6Z)-2-methylocta-2,4,6-trienyl]propanamide |
| SMILES | C/C=C\C=C/C=C(\C)CNC(=O)CCOC(F)F.CC(N)=O |
| InChI | InChI=1S/C13H19F2NO2.C2H5NO/c1-3-4-5-6-7-11(2)10-16-12(17)8-9-18-13(14)15;1-2(3)4/h3-7,13H,8-10H2,1-2H3,(H,16,17);1H3,(H2,3,4)/b4-3-,6-5-,11-7+; |
| InChIKey | WMWPOTSOYLWMRL-UUNBNUPASA-N |
| XLogP | 2.30 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|