About 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile
2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile (PubChem CID 143690920) has the molecular formula C12H15N3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile |
| PubChem CID | 143690920 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile |
| SMILES | CC1=C(C#N)CC(C#N)=C(C(C)(C)C)N1 |
| InChI | InChI=1S/C12H15N3/c1-8-9(6-13)5-10(7-14)11(15-8)12(2,3)4/h15H,5H2,1-4H3 |
| InChIKey | LDFPDSZLNWPDNL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile?
The IUPAC name of 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile (CID 143690920) is 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile is CC1=C(C#N)CC(C#N)=C(C(C)(C)C)N1.
What is the InChIKey of 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile?
The InChIKey is LDFPDSZLNWPDNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3/c1-8-9(6-13)5-10(7-14)11(15-8)12(2,3)4/h15H,5H2,1-4H3.
What are the key properties of 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile?
2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile has a molecular weight of 201.27 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile is sourced from PubChem (CID 143690920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).