About 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline
3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline (PubChem CID 143691138) has the molecular formula C14H15N3O3
and a molecular weight of 273.29 g/mol. Its IUPAC name is 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline.
Molecular Properties
| Compound Name | 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline |
| PubChem CID | 143691138 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline |
| SMILES | NNOc1cc(-c2cccc(N)c2)cc2c1OCCO2 |
| InChI | InChI=1S/C14H15N3O3/c15-11-3-1-2-9(6-11)10-7-12-14(19-5-4-18-12)13(8-10)20-17-16/h1-3,6-8,17H,4-5,15-16H2 |
| InChIKey | CJDDMWVCVXPDAF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline?
The IUPAC name of 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline (CID 143691138) is 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline.
What is the SMILES notation for 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline?
The canonical SMILES for 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline is NNOc1cc(-c2cccc(N)c2)cc2c1OCCO2.
What is the InChIKey of 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline?
The InChIKey is CJDDMWVCVXPDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3/c15-11-3-1-2-9(6-11)10-7-12-14(19-5-4-18-12)13(8-10)20-17-16/h1-3,6-8,17H,4-5,15-16H2.
What are the key properties of 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline?
3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline has a molecular weight of 273.29 g/mol, XLogP of 1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-hydrazinyloxy-2,3-dihydro-1,4-benzodioxin-7-yl)aniline is sourced from PubChem (CID 143691138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).