C9H12F3NO — CID 143691532
(E)-3-(2,2,2-trifluoroethyliminomethyl)hex-3-en-2-one (PubChem CID 143691532) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is (E)-3-(2,2,2-trifluoroethyliminomethyl)hex-3-en-2-one.
| Compound Name | (E)-3-(2,2,2-trifluoroethyliminomethyl)hex-3-en-2-one |
|---|---|
| PubChem CID | 143691532 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (E)-3-(2,2,2-trifluoroethyliminomethyl)hex-3-en-2-one |
| SMILES | CC/C=C(\C=N\CC(F)(F)F)C(C)=O |
| InChI | InChI=1S/C9H12F3NO/c1-3-4-8(7(2)14)5-13-6-9(10,11)12/h4-5H,3,6H2,1-2H3/b8-4+,13-5+ |
| InChIKey | QJURJUGFTQGANQ-OLOPGVEZSA-N |
| XLogP | 2.54 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|