About (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate
(7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate (PubChem CID 143691584) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate |
| PubChem CID | 143691584 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate |
| SMILES | Cc1c(OC(=O)C(C)(C)C)c2nccnc2[nH]c1=O |
| InChI | InChI=1S/C13H15N3O3/c1-7-9(19-12(18)13(2,3)4)8-10(16-11(7)17)15-6-5-14-8/h5-6H,1-4H3,(H,15,16,17) |
| InChIKey | KVUYMYLVVJRZQW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate?
The IUPAC name of (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate (CID 143691584) is (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate is Cc1c(OC(=O)C(C)(C)C)c2nccnc2[nH]c1=O.
What is the InChIKey of (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate?
The InChIKey is KVUYMYLVVJRZQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3/c1-7-9(19-12(18)13(2,3)4)8-10(16-11(7)17)15-6-5-14-8/h5-6H,1-4H3,(H,15,16,17).
What are the key properties of (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate?
(7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate has a molecular weight of 261.28 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-6-oxo-5H-pyrido[2,3-b]pyrazin-8-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 143691584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).