C13H15NO2 — CID 143691952
(8aS)-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 143691952) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (8aS)-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | (8aS)-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 143691952 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (8aS)-4-phenyl-3,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | O=C1OCC(c2ccccc2)N2CCC[C@@H]12 |
| InChI | InChI=1S/C13H15NO2/c15-13-11-7-4-8-14(11)12(9-16-13)10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2/t11-,12?/m0/s1 |
| InChIKey | ZGJWQCDJCYYICA-PXYINDEMSA-N |
| XLogP | 1.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |