C35H38N2OS — CID 143692731
3-aminosulfanyl-N-[3-(3-cyclobutylphenyl)propyl]-N-(3,3-diphenylpropyl)benzamide (PubChem CID 143692731) has the molecular formula C35H38N2OS and a molecular weight of 534.77 g/mol. Its IUPAC name is 3-aminosulfanyl-N-[3-(3-cyclobutylphenyl)propyl]-N-(3,3-diphenylpropyl)benzamide.
| Compound Name | 3-aminosulfanyl-N-[3-(3-cyclobutylphenyl)propyl]-N-(3,3-diphenylpropyl)benzamide |
|---|---|
| PubChem CID | 143692731 |
| Molecular Formula | C35H38N2OS |
| Molecular Weight | 534.77 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 3-aminosulfanyl-N-[3-(3-cyclobutylphenyl)propyl]-N-(3,3-diphenylpropyl)benzamide |
| SMILES | NSc1cccc(C(=O)N(CCCc2cccc(C3CCC3)c2)CCC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C35H38N2OS/c36-39-33-21-9-20-32(26-33)35(38)37(23-10-12-27-11-7-19-31(25-27)28-17-8-18-28)24-22-34(29-13-3-1-4-14-29)30-15-5-2-6-16-30/h1-7,9,11,13-16,19-21,25-26,28,34H,8,10,12,17-18,22-24,36H2 |
| InChIKey | DNGQGZITWYPFAE-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.77 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|