C37H44N2O2S — CID 143692745
(Z)-N-(3,3-diphenylpropyl)-N-(3-phenylpropyl)-1-pyridin-2-ylbut-1-en-1-amine;ethyl 2-sulfanylacetate (PubChem CID 143692745) has the molecular formula C37H44N2O2S and a molecular weight of 580.84 g/mol. Its IUPAC name is (Z)-N-(3,3-diphenylpropyl)-N-(3-phenylpropyl)-1-pyridin-2-ylbut-1-en-1-amine;ethyl 2-sulfanylacetate.
| Compound Name | (Z)-N-(3,3-diphenylpropyl)-N-(3-phenylpropyl)-1-pyridin-2-ylbut-1-en-1-amine;ethyl 2-sulfanylacetate |
|---|---|
| PubChem CID | 143692745 |
| Molecular Formula | C37H44N2O2S |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | (Z)-N-(3,3-diphenylpropyl)-N-(3-phenylpropyl)-1-pyridin-2-ylbut-1-en-1-amine;ethyl 2-sulfanylacetate |
| SMILES | CC/C=C(/c1ccccn1)N(CCCc1ccccc1)CCC(c1ccccc1)c1ccccc1.CCOC(=O)CS |
| InChI | InChI=1S/C33H36N2.C4H8O2S/c1-2-15-33(32-23-12-13-25-34-32)35(26-14-18-28-16-6-3-7-17-28)27-24-31(29-19-8-4-9-20-29)30-21-10-5-11-22-30;1-2-6-4(5)3-7/h3-13,15-17,19-23,25,31H,2,14,18,24,26-27H2,1H3;7H,2-3H2,1H3/b33-15-; |
| InChIKey | IIPWSODPIHKACC-WOMMTIDBSA-N |
| XLogP | 8.47 |
| TPSA | 42.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|