C13H18O7 — CID 143692874
(4,5-diacetyloxy-3-oxabicyclo[4.1.0]heptan-2-yl)methyl acetate (PubChem CID 143692874) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is (4,5-diacetyloxy-3-oxabicyclo[4.1.0]heptan-2-yl)methyl acetate.
| Compound Name | (4,5-diacetyloxy-3-oxabicyclo[4.1.0]heptan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 143692874 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (4,5-diacetyloxy-3-oxabicyclo[4.1.0]heptan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C2CC12 |
| InChI | InChI=1S/C13H18O7/c1-6(14)17-5-11-9-4-10(9)12(18-7(2)15)13(20-11)19-8(3)16/h9-13H,4-5H2,1-3H3 |
| InChIKey | AQKZADCIRQYBEX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|