C19H25F3N2O3S — CID 143693129
1-[4-(2-methyl-1-benzothiophen-5-yl)butyl]piperazine;trifluoromethyl hydrogen carbonate (PubChem CID 143693129) has the molecular formula C19H25F3N2O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is 1-[4-(2-methyl-1-benzothiophen-5-yl)butyl]piperazine;trifluoromethyl hydrogen carbonate.
| Compound Name | 1-[4-(2-methyl-1-benzothiophen-5-yl)butyl]piperazine;trifluoromethyl hydrogen carbonate |
|---|---|
| PubChem CID | 143693129 |
| Molecular Formula | C19H25F3N2O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-[4-(2-methyl-1-benzothiophen-5-yl)butyl]piperazine;trifluoromethyl hydrogen carbonate |
| SMILES | Cc1cc2cc(CCCCN3CCNCC3)ccc2s1.O=C(O)OC(F)(F)F |
| InChI | InChI=1S/C17H24N2S.C2HF3O3/c1-14-12-16-13-15(5-6-17(16)20-14)4-2-3-9-19-10-7-18-8-11-19;3-2(4,5)8-1(6)7/h5-6,12-13,18H,2-4,7-11H2,1H3;(H,6,7) |
| InChIKey | UNPDCPMDEJVLGL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|