C11H15F3N2 — CID 143693367
(3Z)-N-[1-[(E)-1,1,1-trifluoropropan-2-ylideneamino]ethenyl]hexa-1,3-dien-2-amine (PubChem CID 143693367) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is (3Z)-N-[1-[(E)-1,1,1-trifluoropropan-2-ylideneamino]ethenyl]hexa-1,3-dien-2-amine.
| Compound Name | (3Z)-N-[1-[(E)-1,1,1-trifluoropropan-2-ylideneamino]ethenyl]hexa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 143693367 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (3Z)-N-[1-[(E)-1,1,1-trifluoropropan-2-ylideneamino]ethenyl]hexa-1,3-dien-2-amine |
| SMILES | C=C(/C=C\CC)NC(=C)/N=C(\C)C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2/c1-5-6-7-8(2)15-10(4)16-9(3)11(12,13)14/h6-7,15H,2,4-5H2,1,3H3/b7-6-,16-9+ |
| InChIKey | HYCJPDIABVLYAF-GMDIYDSJSA-N |
| XLogP | 3.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|