C12H19NS — CID 143693566
ethane;6-methyl-5,6,7,8-tetrahydroquinoline-7-thiol (PubChem CID 143693566) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is ethane;6-methyl-5,6,7,8-tetrahydroquinoline-7-thiol.
| Compound Name | ethane;6-methyl-5,6,7,8-tetrahydroquinoline-7-thiol |
|---|---|
| PubChem CID | 143693566 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | ethane;6-methyl-5,6,7,8-tetrahydroquinoline-7-thiol |
| SMILES | CC.CC1Cc2cccnc2CC1S |
| InChI | InChI=1S/C10H13NS.C2H6/c1-7-5-8-3-2-4-11-9(8)6-10(7)12;1-2/h2-4,7,10,12H,5-6H2,1H3;1-2H3 |
| InChIKey | FFCFZGSLTZZZLY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|