C17H22BrFO — CID 143693627
(E,4Z)-5-bromo-4-ethylidene-1-(3-fluorophenyl)hept-5-en-1-one;ethane (PubChem CID 143693627) has the molecular formula C17H22BrFO and a molecular weight of 341.26 g/mol. Its IUPAC name is (E,4Z)-5-bromo-4-ethylidene-1-(3-fluorophenyl)hept-5-en-1-one;ethane.
| Compound Name | (E,4Z)-5-bromo-4-ethylidene-1-(3-fluorophenyl)hept-5-en-1-one;ethane |
|---|---|
| PubChem CID | 143693627 |
| Molecular Formula | C17H22BrFO |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (E,4Z)-5-bromo-4-ethylidene-1-(3-fluorophenyl)hept-5-en-1-one;ethane |
| SMILES | C/C=C(CCC(=O)c1cccc(F)c1)\C(Br)=C/C.CC |
| InChI | InChI=1S/C15H16BrFO.C2H6/c1-3-11(14(16)4-2)8-9-15(18)12-6-5-7-13(17)10-12;1-2/h3-7,10H,8-9H2,1-2H3;1-2H3/b11-3-,14-4+; |
| InChIKey | VBEIUWOZDQCZEL-KMBZSHDHSA-N |
| XLogP | 6.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|