About 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen
3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen (PubChem CID 143693778) has the molecular formula C9H24N2O
and a molecular weight of 176.30 g/mol. Its IUPAC name is 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen.
Molecular Properties
| Compound Name | 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen |
| PubChem CID | 143693778 |
| Molecular Formula | C9H24N2O |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.19 |
| IUPAC Name | 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen |
| SMILES | CCC(CCN(C)C)NCOC.[H][H] |
| InChI | InChI=1S/C9H22N2O.H2/c1-5-9(10-8-12-4)6-7-11(2)3;/h9-10H,5-8H2,1-4H3;1H |
| InChIKey | ABDNMXYUDSXBNN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen?
The IUPAC name of 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen (CID 143693778) is 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen.
What is the SMILES notation for 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen?
The canonical SMILES for 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen is CCC(CCN(C)C)NCOC.[H][H].
What is the InChIKey of 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen?
The InChIKey is ABDNMXYUDSXBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O.H2/c1-5-9(10-8-12-4)6-7-11(2)3;/h9-10H,5-8H2,1-4H3;1H.
What are the key properties of 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen?
3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen has a molecular weight of 176.30 g/mol, XLogP of 1.16, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(methoxymethyl)-1-N,1-N-dimethylpentane-1,3-diamine;molecular hydrogen is sourced from PubChem (CID 143693778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).