C25H48 — CID 143694903
1-(5-ethyl-2,7-dimethylnonan-4-yl)-3-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 143694903) has the molecular formula C25H48 and a molecular weight of 348.66 g/mol. Its IUPAC name is 1-(5-ethyl-2,7-dimethylnonan-4-yl)-3-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 1-(5-ethyl-2,7-dimethylnonan-4-yl)-3-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 143694903 |
| Molecular Formula | C25H48 |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 348.38 |
| IUPAC Name | 1-(5-ethyl-2,7-dimethylnonan-4-yl)-3-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCCC1CC(C(CC(C)C)C(CC)CC(C)CC)C2CCCCC12 |
| InChI | InChI=1S/C25H48/c1-7-12-21-17-25(23-14-11-10-13-22(21)23)24(15-18(4)5)20(9-3)16-19(6)8-2/h18-25H,7-17H2,1-6H3 |
| InChIKey | KXTJUCJXTFQTGC-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |