About butane;ethane;4-methoxy-6-methylpyrimidine
butane;ethane;4-methoxy-6-methylpyrimidine (PubChem CID 143694997) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is butane;ethane;4-methoxy-6-methylpyrimidine.
Molecular Properties
| Compound Name | butane;ethane;4-methoxy-6-methylpyrimidine |
| PubChem CID | 143694997 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | butane;ethane;4-methoxy-6-methylpyrimidine |
| SMILES | CC.CCCC.COc1cc(C)ncn1 |
| InChI | InChI=1S/C6H8N2O.C4H10.C2H6/c1-5-3-6(9-2)8-4-7-5;1-3-4-2;1-2/h3-4H,1-2H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | WVKPSSIMCRPKME-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane;ethane;4-methoxy-6-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;4-methoxy-6-methylpyrimidine?
The IUPAC name of butane;ethane;4-methoxy-6-methylpyrimidine (CID 143694997) is butane;ethane;4-methoxy-6-methylpyrimidine.
What is the SMILES notation for butane;ethane;4-methoxy-6-methylpyrimidine?
The canonical SMILES for butane;ethane;4-methoxy-6-methylpyrimidine is CC.CCCC.COc1cc(C)ncn1.
What is the InChIKey of butane;ethane;4-methoxy-6-methylpyrimidine?
The InChIKey is WVKPSSIMCRPKME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O.C4H10.C2H6/c1-5-3-6(9-2)8-4-7-5;1-3-4-2;1-2/h3-4H,1-2H3;3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;4-methoxy-6-methylpyrimidine?
butane;ethane;4-methoxy-6-methylpyrimidine has a molecular weight of 212.34 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;4-methoxy-6-methylpyrimidine is sourced from PubChem (CID 143694997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).