C22H23ClF3N3O4 — CID 143695545
1-(2-chlorophenyl)-5-ethoxy-3-(trifluoromethyl)pyrazole;N-(4,5-dimethoxy-2-methylphenyl)formamide (PubChem CID 143695545) has the molecular formula C22H23ClF3N3O4 and a molecular weight of 485.89 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-ethoxy-3-(trifluoromethyl)pyrazole;N-(4,5-dimethoxy-2-methylphenyl)formamide.
| Compound Name | 1-(2-chlorophenyl)-5-ethoxy-3-(trifluoromethyl)pyrazole;N-(4,5-dimethoxy-2-methylphenyl)formamide |
|---|---|
| PubChem CID | 143695545 |
| Molecular Formula | C22H23ClF3N3O4 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-(2-chlorophenyl)-5-ethoxy-3-(trifluoromethyl)pyrazole;N-(4,5-dimethoxy-2-methylphenyl)formamide |
| SMILES | CCOc1cc(C(F)(F)F)nn1-c1ccccc1Cl.COc1cc(C)c(NC=O)cc1OC |
| InChI | InChI=1S/C12H10ClF3N2O.C10H13NO3/c1-2-19-11-7-10(12(14,15)16)17-18(11)9-6-4-3-5-8(9)13;1-7-4-9(13-2)10(14-3)5-8(7)11-6-12/h3-7H,2H2,1H3;4-6H,1-3H3,(H,11,12) |
| InChIKey | MSMOQLLPQGHJBF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|