C10H21NO3 — CID 143695712
(Z)-6,6-dimethyl-1-(methylamino)hept-2-ene-1,1,2-triol (PubChem CID 143695712) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is (Z)-6,6-dimethyl-1-(methylamino)hept-2-ene-1,1,2-triol.
| Compound Name | (Z)-6,6-dimethyl-1-(methylamino)hept-2-ene-1,1,2-triol |
|---|---|
| PubChem CID | 143695712 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (Z)-6,6-dimethyl-1-(methylamino)hept-2-ene-1,1,2-triol |
| SMILES | CNC(O)(O)/C(O)=C/CCC(C)(C)C |
| InChI | InChI=1S/C10H21NO3/c1-9(2,3)7-5-6-8(12)10(13,14)11-4/h6,11-14H,5,7H2,1-4H3/b8-6- |
| InChIKey | UBUMJWPKAMYBCW-VURMDHGXSA-N |
| XLogP | 1.11 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|