C24H29N5O — CID 1436961
2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 1436961) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 1436961 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CN1CCC(c2nc3ccccc3[nH]2)CC1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C24H29N5O/c30-23(25-19-7-9-20(10-8-19)29-13-3-4-14-29)17-28-15-11-18(12-16-28)24-26-21-5-1-2-6-22(21)27-24/h1-2,5-10,18H,3-4,11-17H2,(H,25,30)(H,26,27) |
| InChIKey | BNLQOPBEZCZKFT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|