C17H21N3O — CID 143696230
N-methyl-3-(1-pyridin-3-yl-3,4-dihydro-2,1-benzoxazin-3-yl)propan-1-amine (PubChem CID 143696230) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is N-methyl-3-(1-pyridin-3-yl-3,4-dihydro-2,1-benzoxazin-3-yl)propan-1-amine.
| Compound Name | N-methyl-3-(1-pyridin-3-yl-3,4-dihydro-2,1-benzoxazin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 143696230 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-methyl-3-(1-pyridin-3-yl-3,4-dihydro-2,1-benzoxazin-3-yl)propan-1-amine |
| SMILES | CNCCCC1Cc2ccccc2N(c2cccnc2)O1 |
| InChI | InChI=1S/C17H21N3O/c1-18-10-5-8-16-12-14-6-2-3-9-17(14)20(21-16)15-7-4-11-19-13-15/h2-4,6-7,9,11,13,16,18H,5,8,10,12H2,1H3 |
| InChIKey | FHQZDKIXWOZHFK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|