C18H19F3N2O — CID 143696270
3-[1-(2,5-difluorophenyl)-6-fluoro-3,4-dihydro-2,1-benzoxazin-3-yl]-N-methylpropan-1-amine (PubChem CID 143696270) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is 3-[1-(2,5-difluorophenyl)-6-fluoro-3,4-dihydro-2,1-benzoxazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[1-(2,5-difluorophenyl)-6-fluoro-3,4-dihydro-2,1-benzoxazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 143696270 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-[1-(2,5-difluorophenyl)-6-fluoro-3,4-dihydro-2,1-benzoxazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCC1Cc2cc(F)ccc2N(c2cc(F)ccc2F)O1 |
| InChI | InChI=1S/C18H19F3N2O/c1-22-8-2-3-15-10-12-9-13(19)5-7-17(12)23(24-15)18-11-14(20)4-6-16(18)21/h4-7,9,11,15,22H,2-3,8,10H2,1H3 |
| InChIKey | BYUALFVCCCZYCI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|