C10H16FN — CID 143696624
(3Z)-4-fluoro-N,N,6-trimethylhepta-1,3,5-trien-3-amine (PubChem CID 143696624) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (3Z)-4-fluoro-N,N,6-trimethylhepta-1,3,5-trien-3-amine.
| Compound Name | (3Z)-4-fluoro-N,N,6-trimethylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143696624 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (3Z)-4-fluoro-N,N,6-trimethylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C(/F)C=C(C)C)N(C)C |
| InChI | InChI=1S/C10H16FN/c1-6-10(12(4)5)9(11)7-8(2)3/h6-7H,1H2,2-5H3/b10-9- |
| InChIKey | XQPRXJVHQDVRKC-KTKRTIGZSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|