C10H18FN — CID 143696626
(2E,4E)-4-fluoro-N,N,5-trimethylhepta-2,4-dien-2-amine (PubChem CID 143696626) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is (2E,4E)-4-fluoro-N,N,5-trimethylhepta-2,4-dien-2-amine.
| Compound Name | (2E,4E)-4-fluoro-N,N,5-trimethylhepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 143696626 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (2E,4E)-4-fluoro-N,N,5-trimethylhepta-2,4-dien-2-amine |
| SMILES | CC/C(C)=C(F)\C=C(/C)N(C)C |
| InChI | InChI=1S/C10H18FN/c1-6-8(2)10(11)7-9(3)12(4)5/h7H,6H2,1-5H3/b9-7+,10-8+ |
| InChIKey | HYCMGUGSRALQPS-FIFLTTCUSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|