C22H45NS — CID 143697585
ethane;(2E,4Z)-3-(ethylsulfanylmethyl)octa-2,4-diene;(2E)-3-methylhexa-2,5-dien-2-amine (PubChem CID 143697585) has the molecular formula C22H45NS and a molecular weight of 355.68 g/mol. Its IUPAC name is ethane;(2E,4Z)-3-(ethylsulfanylmethyl)octa-2,4-diene;(2E)-3-methylhexa-2,5-dien-2-amine.
| Compound Name | ethane;(2E,4Z)-3-(ethylsulfanylmethyl)octa-2,4-diene;(2E)-3-methylhexa-2,5-dien-2-amine |
|---|---|
| PubChem CID | 143697585 |
| Molecular Formula | C22H45NS |
| Molecular Weight | 355.68 g/mol |
| Exact Mass | 355.33 |
| IUPAC Name | ethane;(2E,4Z)-3-(ethylsulfanylmethyl)octa-2,4-diene;(2E)-3-methylhexa-2,5-dien-2-amine |
| SMILES | C/C=C(\C=C/CCC)CSCC.C=CC/C(C)=C(\C)N.CC.CC |
| InChI | InChI=1S/C11H20S.C7H13N.2C2H6/c1-4-7-8-9-11(5-2)10-12-6-3;1-4-5-6(2)7(3)8;2*1-2/h5,8-9H,4,6-7,10H2,1-3H3;4H,1,5,8H2,2-3H3;2*1-2H3/b9-8-,11-5+;7-6+;; |
| InChIKey | DBHFPIUEEZZXCL-KHQDWEJNSA-N |
| XLogP | 7.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.68 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|