C14H17FN4O — CID 143697704
1,8-dimethyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carbonyl fluoride;ethane (PubChem CID 143697704) has the molecular formula C14H17FN4O and a molecular weight of 276.31 g/mol. Its IUPAC name is 1,8-dimethyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carbonyl fluoride;ethane.
| Compound Name | 1,8-dimethyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carbonyl fluoride;ethane |
|---|---|
| PubChem CID | 143697704 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1,8-dimethyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carbonyl fluoride;ethane |
| SMILES | CC.Cc1ncc2c(n1)-c1c(c(C(=O)F)nn1C)CC2 |
| InChI | InChI=1S/C12H11FN4O.C2H6/c1-6-14-5-7-3-4-8-10(12(13)18)16-17(2)11(8)9(7)15-6;1-2/h5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | HQPVRUGUAIWKFH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|