About 4-methyl-1,3-dihydropyrrole-2-thione
4-methyl-1,3-dihydropyrrole-2-thione (PubChem CID 143697998) has the molecular formula C5H7NS
and a molecular weight of 113.18 g/mol. Its IUPAC name is 4-methyl-1,3-dihydropyrrole-2-thione.
Molecular Properties
| Compound Name | 4-methyl-1,3-dihydropyrrole-2-thione |
| PubChem CID | 143697998 |
| Molecular Formula | C5H7NS |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.03 |
| IUPAC Name | 4-methyl-1,3-dihydropyrrole-2-thione |
| SMILES | CC1=CNC(=S)C1 |
| InChI | InChI=1S/C5H7NS/c1-4-2-5(7)6-3-4/h3H,2H2,1H3,(H,6,7) |
| InChIKey | TXUORMVNPAESDA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,3-dihydropyrrole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-dihydropyrrole-2-thione?
The IUPAC name of 4-methyl-1,3-dihydropyrrole-2-thione (CID 143697998) is 4-methyl-1,3-dihydropyrrole-2-thione.
What is the SMILES notation for 4-methyl-1,3-dihydropyrrole-2-thione?
The canonical SMILES for 4-methyl-1,3-dihydropyrrole-2-thione is CC1=CNC(=S)C1.
What is the InChIKey of 4-methyl-1,3-dihydropyrrole-2-thione?
The InChIKey is TXUORMVNPAESDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NS/c1-4-2-5(7)6-3-4/h3H,2H2,1H3,(H,6,7).
What are the key properties of 4-methyl-1,3-dihydropyrrole-2-thione?
4-methyl-1,3-dihydropyrrole-2-thione has a molecular weight of 113.18 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-dihydropyrrole-2-thione is sourced from PubChem (CID 143697998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).