About 3-ethyl-1,2-dihydropyrrole-5-thione
3-ethyl-1,2-dihydropyrrole-5-thione (PubChem CID 143698010) has the molecular formula C6H9NS
and a molecular weight of 127.21 g/mol. Its IUPAC name is 3-ethyl-1,2-dihydropyrrole-5-thione.
Molecular Properties
| Compound Name | 3-ethyl-1,2-dihydropyrrole-5-thione |
| PubChem CID | 143698010 |
| Molecular Formula | C6H9NS |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | 3-ethyl-1,2-dihydropyrrole-5-thione |
| SMILES | CCC1=CC(=S)NC1 |
| InChI | InChI=1S/C6H9NS/c1-2-5-3-6(8)7-4-5/h3H,2,4H2,1H3,(H,7,8) |
| InChIKey | MQQBMTUXKSHXRT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,2-dihydropyrrole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2-dihydropyrrole-5-thione?
The IUPAC name of 3-ethyl-1,2-dihydropyrrole-5-thione (CID 143698010) is 3-ethyl-1,2-dihydropyrrole-5-thione.
What is the SMILES notation for 3-ethyl-1,2-dihydropyrrole-5-thione?
The canonical SMILES for 3-ethyl-1,2-dihydropyrrole-5-thione is CCC1=CC(=S)NC1.
What is the InChIKey of 3-ethyl-1,2-dihydropyrrole-5-thione?
The InChIKey is MQQBMTUXKSHXRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS/c1-2-5-3-6(8)7-4-5/h3H,2,4H2,1H3,(H,7,8).
What are the key properties of 3-ethyl-1,2-dihydropyrrole-5-thione?
3-ethyl-1,2-dihydropyrrole-5-thione has a molecular weight of 127.21 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2-dihydropyrrole-5-thione is sourced from PubChem (CID 143698010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).