About tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane
tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane (PubChem CID 143698092) has the molecular formula C11H23N3OS
and a molecular weight of 245.39 g/mol. Its IUPAC name is tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane |
| PubChem CID | 143698092 |
| Molecular Formula | C11H23N3OS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane |
| SMILES | CCn1cnc(COS(C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C11H23N3OS/c1-7-14-9-12-10(13-14)8-15-16(5,6)11(2,3)4/h9H,7-8H2,1-6H3 |
| InChIKey | OPUJOTBWYNSKQP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane?
The IUPAC name of tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane (CID 143698092) is tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane.
What is the SMILES notation for tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane?
The canonical SMILES for tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane is CCn1cnc(COS(C)(C)C(C)(C)C)n1.
What is the InChIKey of tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane?
The InChIKey is OPUJOTBWYNSKQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3OS/c1-7-14-9-12-10(13-14)8-15-16(5,6)11(2,3)4/h9H,7-8H2,1-6H3.
What are the key properties of tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane?
tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane has a molecular weight of 245.39 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(1-ethyl-1,2,4-triazol-3-yl)methoxy]-dimethyl-λ4-sulfane is sourced from PubChem (CID 143698092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).