C23H20F9NO2 — CID 14369844
ethyl 2-(benzhydrylideneamino)-5,5,6,6,7,7,8,8,8-nonafluorooctanoate (PubChem CID 14369844) has the molecular formula C23H20F9NO2 and a molecular weight of 513.40 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-5,5,6,6,7,7,8,8,8-nonafluorooctanoate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-5,5,6,6,7,7,8,8,8-nonafluorooctanoate |
|---|---|
| PubChem CID | 14369844 |
| Molecular Formula | C23H20F9NO2 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-5,5,6,6,7,7,8,8,8-nonafluorooctanoate |
| SMILES | CCOC(=O)C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20F9NO2/c1-2-35-19(34)17(13-14-20(24,25)21(26,27)22(28,29)23(30,31)32)33-18(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,2,13-14H2,1H3 |
| InChIKey | IGRQPMQIIAQLAE-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|