C29H35N3O5S — CID 143698445
2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethyl N-benzyl-N-[2-[(1-prop-2-enoylcycloheptyl)amino]ethyl]carbamate (PubChem CID 143698445) has the molecular formula C29H35N3O5S and a molecular weight of 537.68 g/mol. Its IUPAC name is 2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethyl N-benzyl-N-[2-[(1-prop-2-enoylcycloheptyl)amino]ethyl]carbamate.
| Compound Name | 2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethyl N-benzyl-N-[2-[(1-prop-2-enoylcycloheptyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 143698445 |
| Molecular Formula | C29H35N3O5S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 2-(4-hydroxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethyl N-benzyl-N-[2-[(1-prop-2-enoylcycloheptyl)amino]ethyl]carbamate |
| SMILES | C=CC(=O)C1(NCCN(Cc2ccccc2)C(=O)OCCc2ccc(O)c3[nH]c(=O)sc23)CCCCCC1 |
| InChI | InChI=1S/C29H35N3O5S/c1-2-24(34)29(15-8-3-4-9-16-29)30-17-18-32(20-21-10-6-5-7-11-21)28(36)37-19-14-22-12-13-23(33)25-26(22)38-27(35)31-25/h2,5-7,10-13,30,33H,1,3-4,8-9,14-20H2,(H,31,35) |
| InChIKey | BXDXLWJQZQZKBJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|