About ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine
ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine (PubChem CID 143699518) has the molecular formula C21H43N
and a molecular weight of 309.58 g/mol. Its IUPAC name is ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine.
Molecular Properties
| Compound Name | ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine |
| PubChem CID | 143699518 |
| Molecular Formula | C21H43N |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 309.34 |
| IUPAC Name | ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine |
| SMILES | C=C(/C=C\N=C(C)C)CCC.CC.CC.CC1CCCCC1 |
| InChI | InChI=1S/C10H17N.C7H14.2C2H6/c1-5-6-10(4)7-8-11-9(2)3;1-7-5-3-2-4-6-7;2*1-2/h7-8H,4-6H2,1-3H3;7H,2-6H2,1H3;2*1-2H3/b8-7-;;; |
| InChIKey | NMGWGEQGUWRUKH-IRYVOTIRSA-N |
| XLogP | 7.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine?
The IUPAC name of ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine (CID 143699518) is ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine.
What is the SMILES notation for ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine?
The canonical SMILES for ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine is C=C(/C=C\N=C(C)C)CCC.CC.CC.CC1CCCCC1.
What is the InChIKey of ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine?
The InChIKey is NMGWGEQGUWRUKH-IRYVOTIRSA-N. The full InChI is InChI=1S/C10H17N.C7H14.2C2H6/c1-5-6-10(4)7-8-11-9(2)3;1-7-5-3-2-4-6-7;2*1-2/h7-8H,4-6H2,1-3H3;7H,2-6H2,1H3;2*1-2H3/b8-7-;;;.
What are the key properties of ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine?
ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine has a molecular weight of 309.58 g/mol, XLogP of 7.98, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methylcyclohexane;N-[(Z)-3-methylidenehex-1-enyl]propan-2-imine is sourced from PubChem (CID 143699518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).