C13H17N3 — CID 143699702
2-methyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]pyrimidin-4-amine (PubChem CID 143699702) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-methyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]pyrimidin-4-amine.
| Compound Name | 2-methyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143699702 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-methyl-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]pyrimidin-4-amine |
| SMILES | C=C/C=C\C=C(/C)CNc1ccnc(C)n1 |
| InChI | InChI=1S/C13H17N3/c1-4-5-6-7-11(2)10-15-13-8-9-14-12(3)16-13/h4-9H,1,10H2,2-3H3,(H,14,15,16)/b6-5-,11-7+ |
| InChIKey | FFNORRJBINEVSW-GNLLZQBYSA-N |
| XLogP | 2.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|