About methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane
methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane (PubChem CID 143699717) has the molecular formula C7H13N2P
and a molecular weight of 156.17 g/mol. Its IUPAC name is methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane.
Molecular Properties
| Compound Name | methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane |
| PubChem CID | 143699717 |
| Molecular Formula | C7H13N2P |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane |
| SMILES | CPc1c(C)nn(C)c1C |
| InChI | InChI=1S/C7H13N2P/c1-5-7(10-4)6(2)9(3)8-5/h10H,1-4H3 |
| InChIKey | RNBDVZOVQDIPRN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane?
The IUPAC name of methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane (CID 143699717) is methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane.
What is the SMILES notation for methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane?
The canonical SMILES for methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane is CPc1c(C)nn(C)c1C.
What is the InChIKey of methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane?
The InChIKey is RNBDVZOVQDIPRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N2P/c1-5-7(10-4)6(2)9(3)8-5/h10H,1-4H3.
What are the key properties of methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane?
methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane has a molecular weight of 156.17 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(1,3,5-trimethylpyrazol-4-yl)phosphane is sourced from PubChem (CID 143699717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).