About N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine
N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine (PubChem CID 143699749) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine |
| PubChem CID | 143699749 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine |
| SMILES | C=C(C(C)C)C1C=C(CC(C)C)C=C/C1=N\C |
| InChI | InChI=1S/C16H25N/c1-11(2)9-14-7-8-16(17-6)15(10-14)13(5)12(3)4/h7-8,10-12,15H,5,9H2,1-4,6H3/b17-16+ |
| InChIKey | GZOOBKQMOBWGGO-WUKNDPDISA-N |
| XLogP | 4.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine?
The IUPAC name of N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine (CID 143699749) is N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine.
What is the SMILES notation for N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine?
The canonical SMILES for N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine is C=C(C(C)C)C1C=C(CC(C)C)C=C/C1=N\C.
What is the InChIKey of N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine?
The InChIKey is GZOOBKQMOBWGGO-WUKNDPDISA-N. The full InChI is InChI=1S/C16H25N/c1-11(2)9-14-7-8-16(17-6)15(10-14)13(5)12(3)4/h7-8,10-12,15H,5,9H2,1-4,6H3/b17-16+.
What are the key properties of N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine?
N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine has a molecular weight of 231.38 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-(3-methylbut-1-en-2-yl)-4-(2-methylpropyl)cyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 143699749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).