C26H22F5N3O2 — CID 143699963
N-[5-[6-(1,1-difluoroprop-2-enyl)-1H-benzimidazol-2-yl]-1-bicyclo[3.1.1]heptanyl]-4-(2,2,2-trifluoroacetyl)benzamide (PubChem CID 143699963) has the molecular formula C26H22F5N3O2 and a molecular weight of 503.47 g/mol. Its IUPAC name is N-[5-[6-(1,1-difluoroprop-2-enyl)-1H-benzimidazol-2-yl]-1-bicyclo[3.1.1]heptanyl]-4-(2,2,2-trifluoroacetyl)benzamide.
| Compound Name | N-[5-[6-(1,1-difluoroprop-2-enyl)-1H-benzimidazol-2-yl]-1-bicyclo[3.1.1]heptanyl]-4-(2,2,2-trifluoroacetyl)benzamide |
|---|---|
| PubChem CID | 143699963 |
| Molecular Formula | C26H22F5N3O2 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-[5-[6-(1,1-difluoroprop-2-enyl)-1H-benzimidazol-2-yl]-1-bicyclo[3.1.1]heptanyl]-4-(2,2,2-trifluoroacetyl)benzamide |
| SMILES | C=CC(F)(F)c1ccc2nc(C34CCCC(NC(=O)c5ccc(C(=O)C(F)(F)F)cc5)(C3)C4)[nH]c2c1 |
| InChI | InChI=1S/C26H22F5N3O2/c1-2-25(27,28)17-8-9-18-19(12-17)33-22(32-18)23-10-3-11-24(13-23,14-23)34-21(36)16-6-4-15(5-7-16)20(35)26(29,30)31/h2,4-9,12H,1,3,10-11,13-14H2,(H,32,33)(H,34,36) |
| InChIKey | OYTYIHOVUPNHQI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|